Boronic acid derivatives
Chembridge Corporation DIBENZO B,D THIEN-2-YLBORONIC
dibenzo[b,d]thien-2-ylboronic acid; CAS: 668983-97-9
Aobchem 3 4-Bis(2 2 2-trifluoroethoxy)benzoic acid | 95% | CAS 35480-54-7 | C11H8F6O4 | 500mg
3 4-Bis(2 2 2-trifluoroethoxy)benzoic acid | 95% | CAS 35480-54-7 | C11H8F6O4 | 500mg
Aobchem 4-Bromo-2-methoxyphenylboronic acid | ≥97% | CAS 889849-21-2 | C7H8BBrO3 | 100g
4-Bromo-2-methoxyphenylboronic acid | ≥97% | CAS 889849-21-2 | C7H8BBrO3 | 100g
eMolecules 137401-45-7 | 2-((tert-Butoxycarbonyl)amino)-3-ethoxy-3-oxopropanoic acid | ChemScene | MFCD09835539 | 247.247 | C10H17NO6 | 97.000 | CCOC(=O)C(NC(=O)OC(C)(C)C)C(O)=O | 25g | 572245531
2-((tert-Butoxycarbonyl)amino)-3-ethoxy-3-oxopropanoic acid | ChemScene | 137401-45-7 | MFCD09835539 | 247.247 | C10H17NO6 | 97.000 | CCOC(=O)C(NC(=O)OC(C)(C)C)C(O)=O | 25g | 572245531
Aobchem 3-Chloro-2-fluorophenylboronic acid | ≥97% | CAS 352535-82-1 | C6H5BClFO2 | 25g
3-Chloro-2-fluorophenylboronic acid | ≥97% | CAS 352535-82-1 | C6H5BClFO2 | 25g
Accela Chembio Inc 3-nitrophenylboronic Acid | 100g | 13331-27-6 | MFCD00007193 | 97+% | Shelf Life: 1260 Days | Moisture Sensitive/+4
3-nitrophenylboronic Acid | 100g | 13331-27-6 | MFCD00007193 | 97+% | Shelf Life: 1260 Days | Moisture Sensitive/+4
Aobchem 2-Aminophenylboronic acid pinacol ester | ≥97% | CAS 191171-55-8 | C12H18BNO2 | 10g
2-Aminophenylboronic acid pinacol ester | ≥97% | CAS 191171-55-8 | C12H18BNO2 | 10g
eMolecules (4-METHOXY-1-METHYL-6-OXO-1,6-DIHYDROPYRIDIN-3-YL)BORONIC ACID | AstaTech |182.970 | C7H10BNO4 | 95.000 | COc1cc(=O)n(C)cc1B(O)O | 0.1g | 781205114
(4-METHOXY-1-METHYL-6-OXO-1,6-DIHYDROPYRIDIN-3-YL)BORONIC ACID | AstaTech |182.970 | C7H10BNO4 | 95.000 | COc1cc(=O)n(C)cc1B(O)O | 0.1g | 781205114
Ambeed 6-bromonaphthalen-2-amine | 7499-66-3 | 222.08 g/mol | 25G
6-bromonaphthalen-2-amine | 7499-66-3 | 222.08 g/mol | 25G
Chem-Impex International, Inc. 4-Cyanophenylboronic acid | MFCD01318968 | 1G
4-Cyanophenylboronic acid, MFCD01318968, 1G
Cayman Chemical OSU03012 Fatty Acids and Deriv
An analog of celecoxib that inhibits PDK-1 (IC50 = 5 µM), and therefore Akt activation, with no measurable COX-2 inhibition up to 50 µM; inhibits tumor cell growth (IC50s ~ 1.1 µM) across a panel of 60 cancer cell lines and induces apoptosis of chronic lymphocytic leukemia cells independent of bcl-2 overexpression using both caspase-dependent and independent pathways